GetWiki

{{Short description|Compound}}{{Use dmy dates|date=November 2023}}{{cs1 config |name-list-style=vanc |display-authors=6}}{{Chembox| ImageFile = Asunaprevir.svg| IUPACName = 3-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-valyl-(4R)-4-[(7-chloro-4-methoxy-1-isoquinolinyl)oxy]-N-{(1R,2S)-1-[(cyclopropylsulfonyl)carbamoyl]-2-vinylcyclopropyl}-L-prolinamide| SystematicName = tert-Butyl {(2S)-1-[(32S,34R,61R,62S)-17-chloro-62-ethenyl-14-methoxy-4,7,9,9-tetraoxo-2-oxa-9λ6-thia-5,8-diaza-1(1)-isoquinolina-3(4,2)-pyrrolidina-6(1,1),10(1)-dicyclopropadecaphan-31-yl]-3,3-dimethyl-1-oxobutan-2-yl}carbamate| OtherNames = BMS-650032|Section1={{Chembox Identifiers| CASNo = 630420-16-5

correct|}}

correct|FDA}}| UNII = S9X0KRJ00S| PubChem = 16076883| ChemSpiderID = 17235944| ChEBI = 134723| DrugBank = DB11586| IUPHAR_ligand = 10882| ChEMBL = 2105735| KEGG = D10093

correct|kegg}}| SMILES = O=C(N5[C@H](C(=O)N[C@@]2(C(=O)NS(=O)(=O)C1CC1)[C@H](C=C)C2)C[C@@H](Oc3ncc(OC)c4c3cc(Cl)cc4)C5)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C| InChI = 1/C35H46ClN5O9S/c1-9-19-16-35(19,31(44)40-51(46,47)22-11-12-22)39-28(42)25-15-21(49-29-24-14-20(36)10-13-23(24)26(48-8)17-37-29)18-41(25)30(43)27(33(2,3)4)38-32(45)50-34(5,6)7/h9-10,13-14,17,19,21-22,25,27H,1,11-12,15-16,18H2,2-8H3,(H,38,45)(H,39,42)(H,40,44)/t19-,21-,25+,27-,35-/m1/s1| InChIKey = XRWSZZJLZRKHHD-WVWIJVSJBJ| StdInChI = 1S/C35H46ClN5O9S/c1-9-19-16-35(19,31(44)40-51(46,47)22-11-12-22)39-28(42)25-15-21(49-29-24-14-20(36)10-13-23(24)26(48-8)17-37-29)18-41(25)30(43)27(33(2,3)4)38-32(45)50-34(5,6)7/h9-10,13-14,17,19,21-22,25,27H,1,11-12,15-16,18H2,2-8H3,(H,38,45)(H,39,42)(H,40,44)/t19-,21-,25+,27-,35-/m1/s1| StdInChIKey = XRWSZZJLZRKHHD-WVWIJVSJSA-N }}|Section2={hide}Chembox Properties

H=46

N=5

S=1| Appearance =| Density =| MeltingPt =| BoilingPt =| Solubility = {edih}| Section6 = {{Chembox Pharmacology| Pharmacology_ref = | ATCCode_prefix = J05| ATCCode_suffix = AP06| ATC_Supplemental = | ATCvet = | Licence_EU = | INN = | INN_EMA = | Licence_US = | Legal_status = | Legal_AU = S4

DATE=21 JUNE 2022

ACCESS-DATE=10 APRIL 2023, | Legal_CA = Rx-only

HEALTH CANADA > DATE=14 MARCH 2017

ACCESS-DATE=7 APRIL 2024, | Legal_NZ = | Legal_NZ_comment = | Legal_UK = | Legal_UK_comment = | Legal_US = | Legal_US_comment = | Legal_EU = | Legal_EU_comment = | Legal_UN = | Legal_UN_comment = | Pregnancy_category = | Pregnancy_AU = | Pregnancy_AU_comment = | Dependence_liability = | AdminRoutes = | Bioavail = | ProteinBound = | Metabolism = | Metabolites = | OnsetOfAction = | HalfLife = | DurationOfAction = | Excretion = }}|Section7={{Chembox Hazards| MainHazards =| FlashPt =| AutoignitionPt = }} }}Asunaprevir (formerly BMS-650032, brand name in Japan and RussiaWEB, Sunvepra (asunaprevir) soft gelatin capsules 100 mg. Registration certificate,weblink State Register of Medicines, 26 August 2015, Russian, Sunvepra) is an experimental drug candidate for the treatment of hepatitis C. It was undergoing development by Bristol-Myers Squibb and has completed Phase III clinical trials in 2013.WEB,weblink A Phase 3 Study in Combination With BMS-790052 and BMS-650032 in Japanese Hepatitis C Virus (HCV) Patients, 23 September 2015, ClinicalTrials.gov, Asunaprevir is an inhibitor of the hepatitis C virus enzyme serine protease NS3.JOURNAL, Asunaprevir. HCV serine protein NS3 inhibitor, Treatment of hepatitis C virus, C. Reviriego, Drugs of the Future, 2012, 37, 4, 247–254, 10.1358/dof.2012.037.04.1789350,weblink Asunaprevir is being tested in combination with pegylated interferon and ribavirin, as well as in interferon-free regimens with other direct-acting antiviral agents including daclatasvir.JOURNAL, Lok AS, Gardiner DF, Lawitz E, Martorell C, Everson GT, Ghalib R, Reindollar R, Rustgi V, McPhee F, Wind-Rotolo M, Persson A, Zhu K, Dimitrova DI, Eley T, Guo T, Grasela DM, Pasquinelli C, Preliminary study of two antiviral agents for hepatitis C genotype 1, The New England Journal of Medicine, 366, 3, 216–24, January 2012, 22256805, 10.1056/NEJMoa1104430, free, WEB,weblink Bristol-Myers' Daclatasvir, Asunaprevir Cured 77%: Study, Bloomberg L.P., Bloomberg, Apr 19, 2012, AASLD: Daclatasvir plus Asunaprevir Rapidly Suppresses HCV in Prior Null Responders {{Webarchive|url=https://web.archive.org/web/20150208163151weblink |date=2015-02-08 }}. Highleyman, L. HIVandHepatitis.com. 8 November 2011. References {{reflist}}{{RNA antivirals}}{{Antiinfective-drug-stub}}